C38H5F13N8 — CID 175621905
2,6-bis[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-4-fluoro-s-indacene-1,5-dicarbonitrile (PubChem CID 175621905) has the molecular formula C38H5F13N8 and a molecular weight of 820.49 g/mol. Its IUPAC name is 2,6-bis[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-4-fluoro-s-indacene-1,5-dicarbonitrile.
| Compound Name | 2,6-bis[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-4-fluoro-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 175621905 |
| Molecular Formula | C38H5F13N8 |
| Molecular Weight | 820.49 g/mol |
| Exact Mass | 820.04 |
| IUPAC Name | 2,6-bis[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,7-bis(dicyanomethylidene)-4-fluoro-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(C(F)(F)F)c(C#N)c(C(F)(F)F)c2)=C(C#N)c2c1cc1c(c2F)C(=C(C#N)C#N)C(c2cc(C(F)(F)F)c(C#N)c(C(F)(F)F)c2)=C1C#N |
| InChI | InChI=1S/C38H5F13N8/c39-34-32-19(30(16(6-52)7-53)29(23(32)13-59)15-3-26(37(46,47)48)22(12-58)27(4-15)38(49,50)51)5-18-20(10-56)28(31(33(18)34)17(8-54)9-55)14-1-24(35(40,41)42)21(11-57)25(2-14)36(43,44)45/h1-5H |
| InChIKey | CDYZTFWKBJORTA-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.49 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|