C35H5F10N7 — CID 175622803
3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile (PubChem CID 175622803) has the molecular formula C35H5F10N7 and a molecular weight of 713.45 g/mol. Its IUPAC name is 3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile.
| Compound Name | 3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 175622803 |
| Molecular Formula | C35H5F10N7 |
| Molecular Weight | 713.45 g/mol |
| Exact Mass | 713.04 |
| IUPAC Name | 3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(F)c(F)c(C(F)(F)F)c2)=C(C#N)c2c1cc1c(c2C#N)C(=C(C#N)C#N)C(c2cc(F)c(F)c(C(F)(F)F)c2)=C1C#N |
| InChI | InChI=1S/C35H5F10N7/c36-24-3-13(1-22(32(24)38)34(40,41)42)26-19(10-50)17-5-18-28(15(6-46)7-47)27(14-2-23(35(43,44)45)33(39)25(37)4-14)20(11-51)30(18)21(12-52)31(17)29(26)16(8-48)9-49/h1-5H |
| InChIKey | IQCDIIZRMHCNKV-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.45 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|