C36H7F7N8 — CID 167122219
2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile (PubChem CID 167122219) has the molecular formula C36H7F7N8 and a molecular weight of 684.49 g/mol. Its IUPAC name is 2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 167122219 |
| Molecular Formula | C36H7F7N8 |
| Molecular Weight | 684.49 g/mol |
| Exact Mass | 684.07 |
| IUPAC Name | 2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C#N)c(C(F)(F)F)c2)=C(C#N)c2c1cc1c(c2F)C(C#N)=C(c2ccc(C#N)c(C(F)(F)F)c2)C1=C(C#N)C#N |
| InChI | InChI=1S/C36H7F7N8/c37-34-32-22(30(20(10-46)11-47)28(24(32)14-50)16-1-3-18(8-44)26(5-16)35(38,39)40)7-23-31(21(12-48)13-49)29(25(15-51)33(23)34)17-2-4-19(9-45)27(6-17)36(41,42)43/h1-7H |
| InChIKey | PBFPMJUKXVQGBP-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.49 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|