C36H6F11N7 — CID 167122222
2-[3,5-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-4,8-difluoro-s-indacene-1,7-dicarbonitrile (PubChem CID 167122222) has the molecular formula C36H6F11N7 and a molecular weight of 745.47 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-4,8-difluoro-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-4,8-difluoro-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 167122222 |
| Molecular Formula | C36H6F11N7 |
| Molecular Weight | 745.47 g/mol |
| Exact Mass | 745.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-4,8-difluoro-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=C(C#N)c2c(F)c3c(c(F)c21)C(=C(C#N)C#N)C(c1ccc(C#N)c(C(F)(F)F)c1)=C3C#N |
| InChI | InChI=1S/C36H6F11N7/c37-32-28-21(12-53)24(14-1-2-15(7-48)23(5-14)36(45,46)47)26(17(8-49)9-50)30(28)33(38)31-27(18(10-51)11-52)25(22(13-54)29(31)32)16-3-19(34(39,40)41)6-20(4-16)35(42,43)44/h1-6H |
| InChIKey | OTYGRUJBQLNCRX-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.47 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|