C32H12F6N4 — CID 146535236
2-[2,7-bis[4-cyano-3-(trifluoromethyl)phenyl]fluoren-9-ylidene]propanedinitrile (PubChem CID 146535236) has the molecular formula C32H12F6N4 and a molecular weight of 566.46 g/mol. Its IUPAC name is 2-[2,7-bis[4-cyano-3-(trifluoromethyl)phenyl]fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[2,7-bis[4-cyano-3-(trifluoromethyl)phenyl]fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 146535236 |
| Molecular Formula | C32H12F6N4 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | 2-[2,7-bis[4-cyano-3-(trifluoromethyl)phenyl]fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3ccc(C#N)c(C(F)(F)F)c3)ccc2-c2ccc(-c3ccc(C#N)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C32H12F6N4/c33-31(34,35)28-11-19(1-3-21(28)13-39)17-5-7-24-25-8-6-18(10-27(25)30(26(24)9-17)23(15-41)16-42)20-2-4-22(14-40)29(12-20)32(36,37)38/h1-12H |
| InChIKey | DFXGLQJANUYYOQ-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|