C36H5F15N6 — CID 175625075
3,5-bis(dicyanomethylidene)-4-fluoro-2,6-bis[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile (PubChem CID 175625075) has the molecular formula C36H5F15N6 and a molecular weight of 806.45 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-4-fluoro-2,6-bis[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-4-fluoro-2,6-bis[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 175625075 |
| Molecular Formula | C36H5F15N6 |
| Molecular Weight | 806.45 g/mol |
| Exact Mass | 806.03 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-4-fluoro-2,6-bis[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(C(F)(F)F)c(F)c(C(F)(F)F)c2)=C(C#N)c2cc3c(c(F)c21)C(=C(C#N)C#N)C(c1cc(C(F)(F)F)c(F)c(C(F)(F)F)c1)=C3C#N |
| InChI | InChI=1S/C36H5F15N6/c37-30-20(33(40,41)42)1-12(2-21(30)34(43,44)45)24-18(10-56)16-5-17-19(11-57)25(13-3-22(35(46,47)48)31(38)23(4-13)36(49,50)51)27(15(8-54)9-55)29(17)32(39)28(16)26(24)14(6-52)7-53/h1-5H |
| InChIKey | GGFFIWYOMMPYIT-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.45 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|