C38H9F12N7 — CID 175619340
2-[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-6-[4-methyl-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile (PubChem CID 175619340) has the molecular formula C38H9F12N7 and a molecular weight of 791.51 g/mol. Its IUPAC name is 2-[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-6-[4-methyl-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2-[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-6-[4-methyl-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 175619340 |
| Molecular Formula | C38H9F12N7 |
| Molecular Weight | 791.51 g/mol |
| Exact Mass | 791.07 |
| IUPAC Name | 2-[4-cyano-3,5-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-6-[4-methyl-3,5-bis(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile |
| SMILES | Cc1c(C(F)(F)F)cc(C2=C(C#N)c3cc4c(cc3C2=C(C#N)C#N)C(=C(C#N)C#N)C(c2cc(C(F)(F)F)c(C#N)c(C(F)(F)F)c2)=C4C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C38H9F12N7/c1-15-27(35(39,40)41)2-16(3-28(15)36(42,43)44)31-24(12-55)20-6-21-23(7-22(20)33(31)18(8-51)9-52)34(19(10-53)11-54)32(25(21)13-56)17-4-29(37(45,46)47)26(14-57)30(5-17)38(48,49)50/h2-7H,1H3 |
| InChIKey | AVVVIYBAJVGUCP-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.51 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|