C34H6F12N8 — CID 175622929
2,6-bis[2,6-bis(trifluoromethyl)-4-pyridinyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile (PubChem CID 175622929) has the molecular formula C34H6F12N8 and a molecular weight of 754.45 g/mol. Its IUPAC name is 2,6-bis[2,6-bis(trifluoromethyl)-4-pyridinyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2,6-bis[2,6-bis(trifluoromethyl)-4-pyridinyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 175622929 |
| Molecular Formula | C34H6F12N8 |
| Molecular Weight | 754.45 g/mol |
| Exact Mass | 754.05 |
| IUPAC Name | 2,6-bis[2,6-bis(trifluoromethyl)-4-pyridinyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(C(F)(F)F)nc(C(F)(F)F)c2)=C(C#N)c2cc3c(cc21)C(=C(C#N)C#N)C(c1cc(C(F)(F)F)nc(C(F)(F)F)c1)=C3C#N |
| InChI | InChI=1S/C34H6F12N8/c35-31(36,37)23-1-13(2-24(53-23)32(38,39)40)27-21(11-51)17-5-18-20(6-19(17)29(27)15(7-47)8-48)30(16(9-49)10-50)28(22(18)12-52)14-3-25(33(41,42)43)54-26(4-14)34(44,45)46/h1-6H |
| InChIKey | NCGMVRTVLDTJDH-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 168.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.45 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|