C30H6F6N10 — CID 138739094
3,5-bis(dicyanomethylidene)-2,6-bis[5-(trifluoromethyl)pyrimidin-2-yl]-s-indacene-1,7-dicarbonitrile (PubChem CID 138739094) has the molecular formula C30H6F6N10 and a molecular weight of 620.44 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-2,6-bis[5-(trifluoromethyl)pyrimidin-2-yl]-s-indacene-1,7-dicarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-2,6-bis[5-(trifluoromethyl)pyrimidin-2-yl]-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 138739094 |
| Molecular Formula | C30H6F6N10 |
| Molecular Weight | 620.44 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-2,6-bis[5-(trifluoromethyl)pyrimidin-2-yl]-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ncc(C(F)(F)F)cn2)=C(C#N)c2cc3c(cc21)C(=C(C#N)C#N)C(c1ncc(C(F)(F)F)cn1)=C3C#N |
| InChI | InChI=1S/C30H6F6N10/c31-29(32,33)15-9-43-27(44-10-15)25-21(7-41)17-1-18-20(2-19(17)23(25)13(3-37)4-38)24(14(5-39)6-40)26(22(18)8-42)28-45-11-16(12-46-28)30(34,35)36/h1-2,9-12H |
| InChIKey | GRVLJPJRWKWIAV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 194.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|