C35H5F4N9 — CID 175629284
2,6-bis(4-cyano-2,5-difluorophenyl)-3,7-bis(dicyanomethylidene)-s-indacene-1,4,5-tricarbonitrile (PubChem CID 175629284) has the molecular formula C35H5F4N9 and a molecular weight of 627.48 g/mol. Its IUPAC name is 2,6-bis(4-cyano-2,5-difluorophenyl)-3,7-bis(dicyanomethylidene)-s-indacene-1,4,5-tricarbonitrile.
| Compound Name | 2,6-bis(4-cyano-2,5-difluorophenyl)-3,7-bis(dicyanomethylidene)-s-indacene-1,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 175629284 |
| Molecular Formula | C35H5F4N9 |
| Molecular Weight | 627.48 g/mol |
| Exact Mass | 627.06 |
| IUPAC Name | 2,6-bis(4-cyano-2,5-difluorophenyl)-3,7-bis(dicyanomethylidene)-s-indacene-1,4,5-tricarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(F)c(C#N)cc2F)=C(C#N)c2c1cc1c(c2C#N)C(=C(C#N)C#N)C(c2cc(F)c(C#N)cc2F)=C1C#N |
| InChI | InChI=1S/C35H5F4N9/c36-26-4-20(28(38)1-15(26)6-40)34-23(12-46)19-3-22-30(17(8-42)9-43)35(21-5-27(37)16(7-41)2-29(21)39)25(14-48)32(22)24(13-47)33(19)31(34)18(10-44)11-45/h1-5H |
| InChIKey | SSNGGANHDCGSDE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 214.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.48 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|