C36H2F6N10 — CID 175629154
2,6-bis(4-cyano-2,3,5-trifluorophenyl)-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile (PubChem CID 175629154) has the molecular formula C36H2F6N10 and a molecular weight of 688.47 g/mol. Its IUPAC name is 2,6-bis(4-cyano-2,3,5-trifluorophenyl)-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile.
| Compound Name | 2,6-bis(4-cyano-2,3,5-trifluorophenyl)-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile |
|---|---|
| PubChem CID | 175629154 |
| Molecular Formula | C36H2F6N10 |
| Molecular Weight | 688.47 g/mol |
| Exact Mass | 688.04 |
| IUPAC Name | 2,6-bis(4-cyano-2,3,5-trifluorophenyl)-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(F)c(C#N)c(F)c2F)=C(C#N)c2c(C#N)c3c(c(C#N)c21)C(=C(C#N)C#N)C(c1cc(F)c(C#N)c(F)c1F)=C3C#N |
| InChI | InChI=1S/C36H2F6N10/c37-23-1-15(33(39)35(41)17(23)7-47)27-19(9-49)29-21(11-51)30-20(10-50)28(16-2-24(38)18(8-48)36(42)34(16)40)26(14(5-45)6-46)32(30)22(12-52)31(29)25(27)13(3-43)4-44/h1-2H |
| InChIKey | TVRLDYFHLCHOON-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 237.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.47 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|