C36H2F6N10 — CID 171766803
(3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5-trifluorophenyl)-5-isocyano-6-(2,3,5-trifluoro-4-isocyanophenyl)-s-indacene-1,4,8-tricarbonitrile (PubChem CID 171766803) has the molecular formula C36H2F6N10 and a molecular weight of 688.47 g/mol. Its IUPAC name is (3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5-trifluorophenyl)-5-isocyano-6-(2,3,5-trifluoro-4-isocyanophenyl)-s-indacene-1,4,8-tricarbonitrile.
| Compound Name | (3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5-trifluorophenyl)-5-isocyano-6-(2,3,5-trifluoro-4-isocyanophenyl)-s-indacene-1,4,8-tricarbonitrile |
|---|---|
| PubChem CID | 171766803 |
| Molecular Formula | C36H2F6N10 |
| Molecular Weight | 688.47 g/mol |
| Exact Mass | 688.04 |
| IUPAC Name | (3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5-trifluorophenyl)-5-isocyano-6-(2,3,5-trifluoro-4-isocyanophenyl)-s-indacene-1,4,8-tricarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2cc(F)c([N+]#[C-])c(F)c2F)/C(=C(/C#N)[N+]#[C-])c2c(C#N)c3c(c(C#N)c21)/C(=C(/C#N)[N+]#[C-])C(c1cc(F)c(C#N)c(F)c1F)=C3C#N |
| InChI | InChI=1S/C36H2F6N10/c1-49-21(11-47)29-23(13-5-19(37)15(7-43)33(41)31(13)39)16(8-44)24-17(9-45)26-28(18(10-46)25(24)29)36(52-4)27(30(26)22(12-48)50-2)14-6-20(38)35(51-3)34(42)32(14)40/h5-6H/b29-21-,30-22- |
| InChIKey | RMPIDCHGPQDKKI-DHQAUHHZSA-N |
| XLogP | 8.24 |
| TPSA | 160.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.47 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|