C34H4F2N12 — CID 171766861
(3E,7Z)-2-(6-cyano-2-fluoro-3-pyridinyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2-fluoro-6-isocyano-3-pyridinyl)-5-isocyano-s-indacene-1,4,8-tricarbonitrile (PubChem CID 171766861) has the molecular formula C34H4F2N12 and a molecular weight of 618.49 g/mol. Its IUPAC name is (3E,7Z)-2-(6-cyano-2-fluoro-3-pyridinyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2-fluoro-6-isocyano-3-pyridinyl)-5-isocyano-s-indacene-1,4,8-tricarbonitrile.
| Compound Name | (3E,7Z)-2-(6-cyano-2-fluoro-3-pyridinyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2-fluoro-6-isocyano-3-pyridinyl)-5-isocyano-s-indacene-1,4,8-tricarbonitrile |
|---|---|
| PubChem CID | 171766861 |
| Molecular Formula | C34H4F2N12 |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | (3E,7Z)-2-(6-cyano-2-fluoro-3-pyridinyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2-fluoro-6-isocyano-3-pyridinyl)-5-isocyano-s-indacene-1,4,8-tricarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc([N+]#[C-])nc2F)/C(=C(/C#N)[N+]#[C-])c2c(C#N)c3c(c(C#N)c21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C#N)nc1F)=C3C#N |
| InChI | InChI=1S/C34H4F2N12/c1-43-21(13-41)30-24(16-6-5-15(9-37)47-33(16)35)18(10-38)25-19(11-39)27-29(20(12-40)26(25)30)32(46-4)28(31(27)22(14-42)44-2)17-7-8-23(45-3)48-34(17)36/h5-8H/b30-21-,31-22- |
| InChIKey | UBCGHAQFEFJUCY-XRGQFMHNSA-N |
| XLogP | 6.48 |
| TPSA | 185.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|