C32H10F2N6 — CID 155618527
(3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-2,6-diphenyl-s-indacene-1,7-dicarbonitrile (PubChem CID 155618527) has the molecular formula C32H10F2N6 and a molecular weight of 516.47 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-2,6-diphenyl-s-indacene-1,7-dicarbonitrile.
| Compound Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-2,6-diphenyl-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 155618527 |
| Molecular Formula | C32H10F2N6 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-2,6-diphenyl-s-indacene-1,7-dicarbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C(c2ccccc2)=C(C#N)c2c(F)c3c(c(F)c21)/C(=C(\C#N)[N+]#[C-])C(c1ccccc1)=C3C#N |
| InChI | InChI=1S/C32H10F2N6/c1-39-21(15-37)27-23(17-9-5-3-6-10-17)19(13-35)25-29(27)32(34)30-26(31(25)33)20(14-36)24(18-11-7-4-8-12-18)28(30)22(16-38)40-2/h3-12H/b27-21-,28-22+ |
| InChIKey | CAABPOAFSBYTFA-KKTFQPMKSA-N |
| XLogP | 7.17 |
| TPSA | 103.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|