C36H13F4N7 — CID 165095298
(3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile (PubChem CID 165095298) has the molecular formula C36H13F4N7 and a molecular weight of 619.54 g/mol. Its IUPAC name is (3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile.
| Compound Name | (3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 165095298 |
| Molecular Formula | C36H13F4N7 |
| Molecular Weight | 619.54 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | (3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2cc(C)cc(C)c2)/C(=C(/C#N)[N+]#[C-])c2cc3c(c(F)c21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C(F)(F)F)c(C#N)c1)=C3C#N |
| InChI | InChI=1S/C36H13F4N7/c1-17-8-18(2)10-20(9-17)29-30(26(15-43)45-3)23-12-22-24(14-42)28(19-6-7-25(36(38,39)40)21(11-19)13-41)33(27(16-44)46-4)31(22)34(37)32(23)35(29)47-5/h6-12H,1-2H3/b30-26-,33-27- |
| InChIKey | CYWYOAZLTFHLRG-CSDPBWKISA-N |
| XLogP | 8.89 |
| TPSA | 108.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.54 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|