C35H9F3N8 — CID 164780557
5-[(E)-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,4,6-trifluoro-7-isocyano-8-methyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile (PubChem CID 164780557) has the molecular formula C35H9F3N8 and a molecular weight of 598.51 g/mol. Its IUPAC name is 5-[(E)-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,4,6-trifluoro-7-isocyano-8-methyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[(E)-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,4,6-trifluoro-7-isocyano-8-methyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 164780557 |
| Molecular Formula | C35H9F3N8 |
| Molecular Weight | 598.51 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 5-[(E)-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,4,6-trifluoro-7-isocyano-8-methyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C(F)/C(=C(/C#N)c2cc([N+]#[C-])cc([N+]#[C-])c2)c2c(F)c3c(c(C)c21)/C(=C(\[N+]#[C-])c1cc(C#N)cc(C#N)c1)C(F)=C3C#N |
| InChI | InChI=1S/C35H9F3N8/c1-16-25-28(24(15-42)31(36)30(25)34(45-4)20-7-17(12-39)6-18(8-20)13-40)32(37)29-26(16)35(46-5)33(38)27(29)23(14-41)19-9-21(43-2)11-22(10-19)44-3/h6-11H,1H3/b27-23-,34-30+ |
| InChIKey | RLQNSSGQLQDVBM-FNULMQINSA-N |
| XLogP | 8.99 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.51 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|