C46H18N8 — CID 153492806
5-[(E)-[(7E)-3-cyano-7-[cyano-(3,5-diisocyanophenyl)methylidene]-5-isocyano-2,6-diphenyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile (PubChem CID 153492806) has the molecular formula C46H18N8 and a molecular weight of 682.71 g/mol. Its IUPAC name is 5-[(E)-[(7E)-3-cyano-7-[cyano-(3,5-diisocyanophenyl)methylidene]-5-isocyano-2,6-diphenyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[(E)-[(7E)-3-cyano-7-[cyano-(3,5-diisocyanophenyl)methylidene]-5-isocyano-2,6-diphenyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 153492806 |
| Molecular Formula | C46H18N8 |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | 5-[(E)-[(7E)-3-cyano-7-[cyano-(3,5-diisocyanophenyl)methylidene]-5-isocyano-2,6-diphenyl-s-indacen-1-ylidene]-isocyanomethyl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccccc2)/C(=C(/C#N)c2cc([N+]#[C-])cc([N+]#[C-])c2)c2cc3c(cc21)C(C#N)=C(c1ccccc1)/C3=C(/[N+]#[C-])c1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C46H18N8/c1-51-33-18-31(19-34(20-33)52-2)39(25-49)43-37-22-36-35(21-38(37)46(54-4)42(43)30-13-9-6-10-14-30)40(26-50)41(29-11-7-5-8-12-29)44(36)45(53-3)32-16-27(23-47)15-28(17-32)24-48/h5-22H/b43-39-,45-44+ |
| InChIKey | UPXNNZAYWBROMD-DTNUZDQTSA-N |
| XLogP | 11.00 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|