C46H18N8 — CID 153489523
(3Z,7E)-7-[cyano-(4-isocyanophenyl)methylidene]-3-[(4-cyanophenyl)-isocyanomethylidene]-5-isocyano-2,6-diphenyl-s-indacene-1,4,8-tricarbonitrile (PubChem CID 153489523) has the molecular formula C46H18N8 and a molecular weight of 682.71 g/mol. Its IUPAC name is (3Z,7E)-7-[cyano-(4-isocyanophenyl)methylidene]-3-[(4-cyanophenyl)-isocyanomethylidene]-5-isocyano-2,6-diphenyl-s-indacene-1,4,8-tricarbonitrile.
| Compound Name | (3Z,7E)-7-[cyano-(4-isocyanophenyl)methylidene]-3-[(4-cyanophenyl)-isocyanomethylidene]-5-isocyano-2,6-diphenyl-s-indacene-1,4,8-tricarbonitrile |
|---|---|
| PubChem CID | 153489523 |
| Molecular Formula | C46H18N8 |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | (3Z,7E)-7-[cyano-(4-isocyanophenyl)methylidene]-3-[(4-cyanophenyl)-isocyanomethylidene]-5-isocyano-2,6-diphenyl-s-indacene-1,4,8-tricarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccccc2)/C(=C(/C#N)c2ccc([N+]#[C-])cc2)c2c(C#N)c3c(c(C#N)c21)/C(=C(\[N+]#[C-])c1ccc(C#N)cc1)C(c1ccccc1)=C3C#N |
| InChI | InChI=1S/C46H18N8/c1-52-32-20-18-28(19-21-32)33(23-48)40-38(30-12-8-5-9-13-30)46(54-3)43-36(26-51)41-39(35(25-50)42(40)43)34(24-49)37(29-10-6-4-7-11-29)44(41)45(53-2)31-16-14-27(22-47)15-17-31/h4-21H/b40-33+,45-44- |
| InChIKey | MDSMDDKMYJFVTR-JQLWRMCJSA-N |
| XLogP | 10.32 |
| TPSA | 132.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|