C46H16F2N8 — CID 170527159
5-[(E)-cyano-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,6-bis(4-fluorophenyl)-7-isocyano-s-indacen-1-ylidene]methyl]benzene-1,3-dicarbonitrile (PubChem CID 170527159) has the molecular formula C46H16F2N8 and a molecular weight of 718.69 g/mol. Its IUPAC name is 5-[(E)-cyano-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,6-bis(4-fluorophenyl)-7-isocyano-s-indacen-1-ylidene]methyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[(E)-cyano-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,6-bis(4-fluorophenyl)-7-isocyano-s-indacen-1-ylidene]methyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 170527159 |
| Molecular Formula | C46H16F2N8 |
| Molecular Weight | 718.69 g/mol |
| Exact Mass | 718.15 |
| IUPAC Name | 5-[(E)-cyano-[(5E)-3-cyano-5-[cyano-(3,5-diisocyanophenyl)methylidene]-2,6-bis(4-fluorophenyl)-7-isocyano-s-indacen-1-ylidene]methyl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(F)cc2)/C(=C(/C#N)c2cc([N+]#[C-])cc([N+]#[C-])c2)c2cc3c(cc21)/C(=C(\C#N)c1cc(C#N)cc(C#N)c1)C(c1ccc(F)cc1)=C3C#N |
| InChI | InChI=1S/C46H16F2N8/c1-54-33-15-30(16-34(17-33)55-2)40(23-52)45-37-18-35-36(19-38(37)46(56-3)43(45)28-6-10-32(48)11-7-28)44(42(41(35)24-53)27-4-8-31(47)9-5-27)39(22-51)29-13-25(20-49)12-26(14-29)21-50/h4-19H/b44-39-,45-40- |
| InChIKey | CQCIFQRHFLIXLT-CSZLEYPDSA-N |
| XLogP | 10.93 |
| TPSA | 132.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.69 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|