C48H19F3N8O — CID 167090896
(3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile (PubChem CID 167090896) has the molecular formula C48H19F3N8O and a molecular weight of 780.73 g/mol. Its IUPAC name is (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile.
| Compound Name | (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 167090896 |
| Molecular Formula | C48H19F3N8O |
| Molecular Weight | 780.73 g/mol |
| Exact Mass | 780.16 |
| IUPAC Name | (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile |
| SMILES | Cc1ccc(C2=C(C#N)c3cc4c(cc3/C2=C(\C#N)c2cc(C#N)cc(C#N)c2)C(C#N)=C(c2ccc(OC(F)(F)F)cc2)/C4=C(/C#N)c2cc(C#N)cc(C#N)c2)cc1 |
| InChI | InChI=1S/C48H19F3N8O/c1-26-2-4-31(5-3-26)44-42(24-58)36-16-39-37(17-38(36)46(44)40(22-56)33-12-27(18-52)10-28(13-33)19-53)43(25-59)45(32-6-8-35(9-7-32)60-48(49,50)51)47(39)41(23-57)34-14-29(20-54)11-30(15-34)21-55/h2-17H,1H3/b46-40-,47-41- |
| InChIKey | AYBJHYMUKVGEBA-XFMBBMCESA-N |
| XLogP | 10.15 |
| TPSA | 199.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.73 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|