C36H17F3N4 — CID 161086357
(2E)-2-[(10Z)-10-[cyano(isocyano)methylidene]-7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]indeno[2,1-a]inden-5-ylidene]-2-isocyanoacetonitrile (PubChem CID 161086357) has the molecular formula C36H17F3N4 and a molecular weight of 562.55 g/mol. Its IUPAC name is (2E)-2-[(10Z)-10-[cyano(isocyano)methylidene]-7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]indeno[2,1-a]inden-5-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(10Z)-10-[cyano(isocyano)methylidene]-7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]indeno[2,1-a]inden-5-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 161086357 |
| Molecular Formula | C36H17F3N4 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | (2E)-2-[(10Z)-10-[cyano(isocyano)methylidene]-7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]indeno[2,1-a]inden-5-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C2=C(/C(=C(\C#N)[N+]#[C-])c3cc(-c4ccc(C)cc4)ccc32)c2ccc(-c3ccc(C(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C36H17F3N4/c1-20-4-6-21(7-5-20)23-10-14-26-28(16-23)32(30(18-40)42-2)35-27-15-11-24(22-8-12-25(13-9-22)36(37,38)39)17-29(27)33(34(26)35)31(19-41)43-3/h4-17H,1H3/b32-30+,33-31- |
| InChIKey | RWJPOJKIWXRLNS-DPNLOZQFSA-N |
| XLogP | 9.59 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|