C40H19F3N4O — CID 58509761
(2E)-2-[(6Z)-6-[cyano(isocyano)methylidene]-2-(3-methylphenyl)-8-[3-(trifluoromethoxy)phenyl]indeno[1,2-b]fluoren-12-ylidene]-2-isocyanoacetonitrile (PubChem CID 58509761) has the molecular formula C40H19F3N4O and a molecular weight of 628.61 g/mol. Its IUPAC name is (2E)-2-[(6Z)-6-[cyano(isocyano)methylidene]-2-(3-methylphenyl)-8-[3-(trifluoromethoxy)phenyl]indeno[1,2-b]fluoren-12-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(6Z)-6-[cyano(isocyano)methylidene]-2-(3-methylphenyl)-8-[3-(trifluoromethoxy)phenyl]indeno[1,2-b]fluoren-12-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58509761 |
| Molecular Formula | C40H19F3N4O |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | (2E)-2-[(6Z)-6-[cyano(isocyano)methylidene]-2-(3-methylphenyl)-8-[3-(trifluoromethoxy)phenyl]indeno[1,2-b]fluoren-12-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2cc(-c3cccc(OC(F)(F)F)c3)ccc2-c2cc3c(cc21)-c1ccc(-c2cccc(C)c2)cc1/C3=C(/C#N)[N+]#[C-] |
| InChI | InChI=1S/C40H19F3N4O/c1-22-6-4-7-23(14-22)25-10-12-28-30-18-35-31(19-34(30)38(32(28)16-25)36(20-44)46-2)29-13-11-26(17-33(29)39(35)37(21-45)47-3)24-8-5-9-27(15-24)48-40(41,42)43/h4-19H,1H3/b38-36+,39-37- |
| InChIKey | OUPVLFZMAWRIFG-VAXAQTQESA-N |
| XLogP | 10.59 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|