C32H18F6N2O — CID 158136083
(2E)-2-isocyano-2-[2-methyl-3-(3-methylphenyl)-7-(trifluoromethoxy)-6-[3-(trifluoromethyl)phenyl]fluoren-9-ylidene]acetonitrile (PubChem CID 158136083) has the molecular formula C32H18F6N2O and a molecular weight of 560.50 g/mol. Its IUPAC name is (2E)-2-isocyano-2-[2-methyl-3-(3-methylphenyl)-7-(trifluoromethoxy)-6-[3-(trifluoromethyl)phenyl]fluoren-9-ylidene]acetonitrile.
| Compound Name | (2E)-2-isocyano-2-[2-methyl-3-(3-methylphenyl)-7-(trifluoromethoxy)-6-[3-(trifluoromethyl)phenyl]fluoren-9-ylidene]acetonitrile |
|---|---|
| PubChem CID | 158136083 |
| Molecular Formula | C32H18F6N2O |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | (2E)-2-isocyano-2-[2-methyl-3-(3-methylphenyl)-7-(trifluoromethoxy)-6-[3-(trifluoromethyl)phenyl]fluoren-9-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\c2cc(C)c(-c3cccc(C)c3)cc2-c2cc(-c3cccc(C(F)(F)F)c3)c(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C32H18F6N2O/c1-17-6-4-7-19(10-17)22-13-24-25-14-23(20-8-5-9-21(12-20)31(33,34)35)29(41-32(36,37)38)15-27(25)30(28(16-39)40-3)26(24)11-18(22)2/h4-15H,1-2H3/b30-28+ |
| InChIKey | MASOAKZIAZACQD-SJCQXOIGSA-N |
| XLogP | 9.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|