C34H6F4N8 — CID 158023414
(3E,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1-carbonitrile (PubChem CID 158023414) has the molecular formula C34H6F4N8 and a molecular weight of 602.47 g/mol. Its IUPAC name is (3E,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1-carbonitrile.
| Compound Name | (3E,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 158023414 |
| Molecular Formula | C34H6F4N8 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | (3E,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2c(F)cc([N+]#[C-])cc2F)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)/C(=C(/C#N)[N+]#[C-])C(c1c(F)cc(C#N)cc1F)=C3C#N |
| InChI | InChI=1S/C34H6F4N8/c1-43-16-7-24(37)32(25(38)8-16)33-29(27(14-42)45-3)19-9-17-18(10-20(19)34(33)46-4)28(26(13-41)44-2)30(21(17)12-40)31-22(35)5-15(11-39)6-23(31)36/h5-10H/b28-26+,29-27- |
| InChIKey | IKATYLYXUFQZBD-ZTCSZMBZSA-N |
| XLogP | 8.22 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|