C36H11F3N8O — CID 158023418
(3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-2-(trifluoromethoxy)phenyl]-5-isocyano-6-(4-isocyano-2-methylphenyl)-s-indacene-1-carbonitrile (PubChem CID 158023418) has the molecular formula C36H11F3N8O and a molecular weight of 628.53 g/mol. Its IUPAC name is (3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-2-(trifluoromethoxy)phenyl]-5-isocyano-6-(4-isocyano-2-methylphenyl)-s-indacene-1-carbonitrile.
| Compound Name | (3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-2-(trifluoromethoxy)phenyl]-5-isocyano-6-(4-isocyano-2-methylphenyl)-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 158023418 |
| Molecular Formula | C36H11F3N8O |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | (3E,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-2-(trifluoromethoxy)phenyl]-5-isocyano-6-(4-isocyano-2-methylphenyl)-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc([N+]#[C-])cc2C)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C#N)cc1OC(F)(F)F)=C3C#N |
| InChI | InChI=1S/C36H11F3N8O/c1-18-10-20(44-2)7-9-21(18)34-33(29(17-43)46-4)25-12-23-24(13-26(25)35(34)47-5)32(28(16-42)45-3)31(27(23)15-41)22-8-6-19(14-40)11-30(22)48-36(37,38)39/h6-13H,1H3/b32-28+,33-29- |
| InChIKey | FJQNMTXXQILQPU-RYJJHBMFSA-N |
| XLogP | 8.87 |
| TPSA | 121.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|