C35H12F4N6 — CID 159803694
(2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyano-6-methylinden-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 159803694) has the molecular formula C35H12F4N6 and a molecular weight of 592.52 g/mol. Its IUPAC name is (2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyano-6-methylinden-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyano-6-methylinden-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 159803694 |
| Molecular Formula | C35H12F4N6 |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | (2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyano-6-methylinden-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc3c(c2)/C(=C(\C#N)[N+]#[C-])c2cc(-c4nc(F)c(F)c(F)c4F)ccc2-3)/C(=C(/C#N)[N+]#[C-])c2cc(C)ccc21 |
| InChI | InChI=1S/C35H12F4N6/c1-16-5-8-21-22(11-16)29(26(15-41)43-3)27(34(21)44-4)17-6-9-19-20-10-7-18(33-31(37)30(36)32(38)35(39)45-33)13-24(20)28(23(19)12-17)25(14-40)42-2/h5-13H,1H3/b28-25-,29-26- |
| InChIKey | CUYHWEPTORKMQS-RZEXXKRKSA-N |
| XLogP | 8.75 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|