C28H10F6N2 — CID 59194454
2-[2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 59194454) has the molecular formula C28H10F6N2 and a molecular weight of 488.39 g/mol. Its IUPAC name is 2-[2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59194454 |
| Molecular Formula | C28H10F6N2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-[2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cc(-c3cc(F)c(F)c(F)c3)ccc2-c2ccc(-c3cc(F)c(F)c(F)c3)cc21 |
| InChI | InChI=1S/C28H10F6N2/c1-36-25(12-35)26-19-6-13(15-8-21(29)27(33)22(30)9-15)2-4-17(19)18-5-3-14(7-20(18)26)16-10-23(31)28(34)24(32)11-16/h2-11H |
| InChIKey | ZYKAAZBMNBZJSX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|