C34H10F6N4 — CID 138572731
2-[10-(dicyanomethylidene)-2,7-bis(3,4,5-trifluorophenyl)indeno[2,1-a]inden-5-ylidene]propanedinitrile (PubChem CID 138572731) has the molecular formula C34H10F6N4 and a molecular weight of 588.47 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2,7-bis(3,4,5-trifluorophenyl)indeno[2,1-a]inden-5-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2,7-bis(3,4,5-trifluorophenyl)indeno[2,1-a]inden-5-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138572731 |
| Molecular Formula | C34H10F6N4 |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2,7-bis(3,4,5-trifluorophenyl)indeno[2,1-a]inden-5-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2=C(C(=C(C#N)C#N)c3cc(-c4cc(F)c(F)c(F)c4)ccc32)c2ccc(-c3cc(F)c(F)c(F)c3)cc21 |
| InChI | InChI=1S/C34H10F6N4/c35-25-7-17(8-26(36)33(25)39)15-1-3-21-23(5-15)29(19(11-41)12-42)32-22-4-2-16(18-9-27(37)34(40)28(38)10-18)6-24(22)30(31(21)32)20(13-43)14-44/h1-10H |
| InChIKey | WJLDQKKSOQHNBM-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|