C33H16F4N4 — CID 166814063
9-(dicyanomethylidene)-2-(2,6-dimethylphenyl)-7-[2-fluoro-6-(trifluoromethyl)phenyl]fluorene-3,6-dicarbonitrile (PubChem CID 166814063) has the molecular formula C33H16F4N4 and a molecular weight of 544.51 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-2-(2,6-dimethylphenyl)-7-[2-fluoro-6-(trifluoromethyl)phenyl]fluorene-3,6-dicarbonitrile.
| Compound Name | 9-(dicyanomethylidene)-2-(2,6-dimethylphenyl)-7-[2-fluoro-6-(trifluoromethyl)phenyl]fluorene-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 166814063 |
| Molecular Formula | C33H16F4N4 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 9-(dicyanomethylidene)-2-(2,6-dimethylphenyl)-7-[2-fluoro-6-(trifluoromethyl)phenyl]fluorene-3,6-dicarbonitrile |
| SMILES | Cc1cccc(C)c1-c1cc2c(cc1C#N)-c1cc(C#N)c(-c3c(F)cccc3C(F)(F)F)cc1C2=C(C#N)C#N |
| InChI | InChI=1S/C33H16F4N4/c1-17-5-3-6-18(2)30(17)22-11-26-24(9-19(22)13-38)25-10-20(14-39)23(12-27(25)31(26)21(15-40)16-41)32-28(33(35,36)37)7-4-8-29(32)34/h3-12H,1-2H3 |
| InChIKey | CGIPAEMALCBYTA-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|