C33H11F7N4 — CID 139501432
2-[12-(dicyanomethylidene)-1,2,3,4-tetrafluoro-8-[3-(trifluoromethyl)phenyl]-6H-indeno[1,2-b]fluoren-6-yl]propanedinitrile (PubChem CID 139501432) has the molecular formula C33H11F7N4 and a molecular weight of 596.47 g/mol. Its IUPAC name is 2-[12-(dicyanomethylidene)-1,2,3,4-tetrafluoro-8-[3-(trifluoromethyl)phenyl]-6H-indeno[1,2-b]fluoren-6-yl]propanedinitrile.
| Compound Name | 2-[12-(dicyanomethylidene)-1,2,3,4-tetrafluoro-8-[3-(trifluoromethyl)phenyl]-6H-indeno[1,2-b]fluoren-6-yl]propanedinitrile |
|---|---|
| PubChem CID | 139501432 |
| Molecular Formula | C33H11F7N4 |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 596.09 |
| IUPAC Name | 2-[12-(dicyanomethylidene)-1,2,3,4-tetrafluoro-8-[3-(trifluoromethyl)phenyl]-6H-indeno[1,2-b]fluoren-6-yl]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc3c(cc2-c2c(F)c(F)c(F)c(F)c21)C(C(C#N)C#N)c1cc(-c2cccc(C(F)(F)F)c2)ccc1-3 |
| InChI | InChI=1S/C33H11F7N4/c34-29-27-24-9-22-20(8-23(24)26(17(12-43)13-44)28(27)30(35)32(37)31(29)36)19-5-4-15(7-21(19)25(22)16(10-41)11-42)14-2-1-3-18(6-14)33(38,39)40/h1-9,16,25H |
| InChIKey | OPKVJSOYBRTPOR-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|