C34H14F7N5 — CID 139501527
2-[10-(dicyanomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]-8-(trifluoromethylamino)-12H-indeno[2,1-b]fluoren-12-yl]propanedinitrile (PubChem CID 139501527) has the molecular formula C34H14F7N5 and a molecular weight of 625.51 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]-8-(trifluoromethylamino)-12H-indeno[2,1-b]fluoren-12-yl]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]-8-(trifluoromethylamino)-12H-indeno[2,1-b]fluoren-12-yl]propanedinitrile |
|---|---|
| PubChem CID | 139501527 |
| Molecular Formula | C34H14F7N5 |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2-[4-fluoro-3-(trifluoromethyl)phenyl]-8-(trifluoromethylamino)-12H-indeno[2,1-b]fluoren-12-yl]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(NC(F)(F)F)ccc2-c2cc3c(cc21)C(C(C#N)C#N)c1cc(-c2ccc(F)c(C(F)(F)F)c2)ccc1-3 |
| InChI | InChI=1S/C34H14F7N5/c35-30-6-2-17(8-29(30)33(36,37)38)16-1-4-21-23-10-24-22-5-3-20(46-34(39,40)41)9-26(22)32(19(14-44)15-45)28(24)11-27(23)31(25(21)7-16)18(12-42)13-43/h1-11,18,31,46H |
| InChIKey | PVXRQOLPVAPJAD-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|