C41H18F8N4 — CID 162609262
2-[12-(dicyanomethylidene)-2,8-bis[4-fluoro-3-(trifluoromethyl)phenyl]-5a-methyl-5H-indeno[2,1-b]fluoren-10-ylidene]propanedinitrile (PubChem CID 162609262) has the molecular formula C41H18F8N4 and a molecular weight of 718.61 g/mol. Its IUPAC name is 2-[12-(dicyanomethylidene)-2,8-bis[4-fluoro-3-(trifluoromethyl)phenyl]-5a-methyl-5H-indeno[2,1-b]fluoren-10-ylidene]propanedinitrile.
| Compound Name | 2-[12-(dicyanomethylidene)-2,8-bis[4-fluoro-3-(trifluoromethyl)phenyl]-5a-methyl-5H-indeno[2,1-b]fluoren-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 162609262 |
| Molecular Formula | C41H18F8N4 |
| Molecular Weight | 718.61 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | 2-[12-(dicyanomethylidene)-2,8-bis[4-fluoro-3-(trifluoromethyl)phenyl]-5a-methyl-5H-indeno[2,1-b]fluoren-10-ylidene]propanedinitrile |
| SMILES | CC12CC3=C(C=C1C(=C(C#N)C#N)c1cc(-c4ccc(F)c(C(F)(F)F)c4)ccc12)C(=C(C#N)C#N)c1cc(-c2ccc(F)c(C(F)(F)F)c2)ccc13 |
| InChI | InChI=1S/C41H18F8N4/c1-39-15-30-26-6-2-20(22-4-8-35(42)32(12-22)40(44,45)46)10-27(26)37(24(16-50)17-51)28(30)14-34(39)38(25(18-52)19-53)29-11-21(3-7-31(29)39)23-5-9-36(43)33(13-23)41(47,48)49/h2-14H,15H2,1H3 |
| InChIKey | IMFUQCAAKCXXCE-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.61 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|