C34H10F8N6O2 — CID 167110306
3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-difluoro-4,8-bis[3-(trifluoromethoxy)phenyl]-3H-s-indacene-1,7-dicarbonitrile (PubChem CID 167110306) has the molecular formula C34H10F8N6O2 and a molecular weight of 686.48 g/mol. Its IUPAC name is 3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-difluoro-4,8-bis[3-(trifluoromethoxy)phenyl]-3H-s-indacene-1,7-dicarbonitrile.
| Compound Name | 3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-difluoro-4,8-bis[3-(trifluoromethoxy)phenyl]-3H-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 167110306 |
| Molecular Formula | C34H10F8N6O2 |
| Molecular Weight | 686.48 g/mol |
| Exact Mass | 686.07 |
| IUPAC Name | 3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-difluoro-4,8-bis[3-(trifluoromethoxy)phenyl]-3H-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(F)=C(C#N)c2c1c(-c1cccc(OC(F)(F)F)c1)c1c(c2-c2cccc(OC(F)(F)F)c2)C(C#N)=C(F)C1C(C#N)C#N |
| InChI | InChI=1S/C34H10F8N6O2/c35-31-21(13-47)27-23(15-3-1-5-19(7-15)49-33(37,38)39)28-22(14-48)32(36)26(18(11-45)12-46)30(28)24(29(27)25(31)17(9-43)10-44)16-4-2-6-20(8-16)50-34(40,41)42/h1-8,17,25H |
| InChIKey | WJQKIZYABWHZFL-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 161.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.48 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|