C30H16N4 — CID 166814043
9-(dicyanomethyl)-3,6-diphenyl-9H-fluorene-2,7-dicarbonitrile (PubChem CID 166814043) has the molecular formula C30H16N4 and a molecular weight of 432.49 g/mol. Its IUPAC name is 9-(dicyanomethyl)-3,6-diphenyl-9H-fluorene-2,7-dicarbonitrile.
| Compound Name | 9-(dicyanomethyl)-3,6-diphenyl-9H-fluorene-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 166814043 |
| Molecular Formula | C30H16N4 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 9-(dicyanomethyl)-3,6-diphenyl-9H-fluorene-2,7-dicarbonitrile |
| SMILES | N#Cc1cc2c(cc1-c1ccccc1)-c1cc(-c3ccccc3)c(C#N)cc1C2C(C#N)C#N |
| InChI | InChI=1S/C30H16N4/c31-15-21-11-28-26(13-24(21)19-7-3-1-4-8-19)27-14-25(20-9-5-2-6-10-20)22(16-32)12-29(27)30(28)23(17-33)18-34/h1-14,23,30H |
| InChIKey | UABXORSUALRVCC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |