C17H9Br2N — CID 102235921
5,8-dibromo-3-phenylnaphthalene-2-carbonitrile (PubChem CID 102235921) has the molecular formula C17H9Br2N and a molecular weight of 387.07 g/mol. Its IUPAC name is 5,8-dibromo-3-phenylnaphthalene-2-carbonitrile.
| Compound Name | 5,8-dibromo-3-phenylnaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 102235921 |
| Molecular Formula | C17H9Br2N |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 5,8-dibromo-3-phenylnaphthalene-2-carbonitrile |
| SMILES | N#Cc1cc2c(Br)ccc(Br)c2cc1-c1ccccc1 |
| InChI | InChI=1S/C17H9Br2N/c18-16-6-7-17(19)15-9-13(11-4-2-1-3-5-11)12(10-20)8-14(15)16/h1-9H |
| InChIKey | CMCSIEFMWJYFTF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |