C30H16N4 — CID 140942929
9-[cyano(isocyano)methyl]-7-isocyano-3,6-diphenyl-9H-fluorene-2-carbonitrile (PubChem CID 140942929) has the molecular formula C30H16N4 and a molecular weight of 432.49 g/mol. Its IUPAC name is 9-[cyano(isocyano)methyl]-7-isocyano-3,6-diphenyl-9H-fluorene-2-carbonitrile.
| Compound Name | 9-[cyano(isocyano)methyl]-7-isocyano-3,6-diphenyl-9H-fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 140942929 |
| Molecular Formula | C30H16N4 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 9-[cyano(isocyano)methyl]-7-isocyano-3,6-diphenyl-9H-fluorene-2-carbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1-c1ccccc1)-c1cc(-c3ccccc3)c(C#N)cc1C2C(C#N)[N+]#[C-] |
| InChI | InChI=1S/C30H16N4/c1-33-28-16-27-25(15-23(28)20-11-7-4-8-12-20)24-14-22(19-9-5-3-6-10-19)21(17-31)13-26(24)30(27)29(18-32)34-2/h3-16,29-30H |
| InChIKey | ICHYNITUONRLGN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|