C21H12N4 — CID 168821648
4-isocyano-5-(4-methyl-5-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile (PubChem CID 168821648) has the molecular formula C21H12N4 and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-isocyano-5-(4-methyl-5-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-isocyano-5-(4-methyl-5-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 168821648 |
| Molecular Formula | C21H12N4 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-isocyano-5-(4-methyl-5-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(C#N)cc1-c1cc(C)c(-c2ccccc2)cn1 |
| InChI | InChI=1S/C21H12N4/c1-14-8-21(25-13-19(14)15-6-4-3-5-7-15)18-9-16(11-22)17(12-23)10-20(18)24-2/h3-10,13H,1H3 |
| InChIKey | WHRKBGSVHJYVAS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|