C20H16N2 — CID 170284634
4-(4,5-dimethyl-2-pyridinyl)-2-phenylbenzonitrile (PubChem CID 170284634) has the molecular formula C20H16N2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(4,5-dimethyl-2-pyridinyl)-2-phenylbenzonitrile.
| Compound Name | 4-(4,5-dimethyl-2-pyridinyl)-2-phenylbenzonitrile |
|---|---|
| PubChem CID | 170284634 |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-(4,5-dimethyl-2-pyridinyl)-2-phenylbenzonitrile |
| SMILES | Cc1cnc(-c2ccc(C#N)c(-c3ccccc3)c2)cc1C |
| InChI | InChI=1S/C20H16N2/c1-14-10-20(22-13-15(14)2)17-8-9-18(12-21)19(11-17)16-6-4-3-5-7-16/h3-11,13H,1-2H3 |
| InChIKey | ICFMMLOVMDBSKY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |