C21H19N — CID 144754626
2-(2-ethenyl-5-phenylphenyl)-4,5-dimethylpyridine (PubChem CID 144754626) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-(2-ethenyl-5-phenylphenyl)-4,5-dimethylpyridine.
| Compound Name | 2-(2-ethenyl-5-phenylphenyl)-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 144754626 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(2-ethenyl-5-phenylphenyl)-4,5-dimethylpyridine |
| SMILES | C=Cc1ccc(-c2ccccc2)cc1-c1cc(C)c(C)cn1 |
| InChI | InChI=1S/C21H19N/c1-4-17-10-11-19(18-8-6-5-7-9-18)13-20(17)21-12-15(2)16(3)14-22-21/h4-14H,1H2,2-3H3 |
| InChIKey | LTUPPDULVAAJBT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |