C19H11N3 — CID 168822091
4-isocyano-3-(5-phenyl-2-pyridinyl)benzonitrile (PubChem CID 168822091) has the molecular formula C19H11N3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-isocyano-3-(5-phenyl-2-pyridinyl)benzonitrile.
| Compound Name | 4-isocyano-3-(5-phenyl-2-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 168822091 |
| Molecular Formula | C19H11N3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-isocyano-3-(5-phenyl-2-pyridinyl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)cc1-c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C19H11N3/c1-21-18-9-7-14(12-20)11-17(18)19-10-8-16(13-22-19)15-5-3-2-4-6-15/h2-11,13H |
| InChIKey | SITGEUYNEYFXRN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|