C26H12N6 — CID 140942890
(2-cyano-7-isocyano-3,6-dipyridin-4-ylfluoren-9-ylidene)cyanamide (PubChem CID 140942890) has the molecular formula C26H12N6 and a molecular weight of 408.42 g/mol. Its IUPAC name is (2-cyano-7-isocyano-3,6-dipyridin-4-ylfluoren-9-ylidene)cyanamide.
| Compound Name | (2-cyano-7-isocyano-3,6-dipyridin-4-ylfluoren-9-ylidene)cyanamide |
|---|---|
| PubChem CID | 140942890 |
| Molecular Formula | C26H12N6 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (2-cyano-7-isocyano-3,6-dipyridin-4-ylfluoren-9-ylidene)cyanamide |
| SMILES | [C-]#[N+]c1cc2c(cc1-c1ccncc1)-c1cc(-c3ccncc3)c(C#N)cc1/C2=N/C#N |
| InChI | InChI=1S/C26H12N6/c1-29-25-13-24-22(12-20(25)17-4-8-31-9-5-17)21-11-19(16-2-6-30-7-3-16)18(14-27)10-23(21)26(24)32-15-28/h2-13H/b32-26- |
| InChIKey | YVSSRSXVIBGCKI-FSRJSHLRSA-N |
| XLogP | 5.53 |
| TPSA | 90.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|