C14H6N4 — CID 168823207
4-isocyano-6-pyridin-2-ylbenzene-1,3-dicarbonitrile (PubChem CID 168823207) has the molecular formula C14H6N4 and a molecular weight of 230.23 g/mol. Its IUPAC name is 4-isocyano-6-pyridin-2-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-isocyano-6-pyridin-2-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 168823207 |
| Molecular Formula | C14H6N4 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-isocyano-6-pyridin-2-ylbenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccccn2)c(C#N)cc1C#N |
| InChI | InChI=1S/C14H6N4/c1-17-14-7-12(13-4-2-3-5-18-13)10(8-15)6-11(14)9-16/h2-7H |
| InChIKey | PABZKKSNPXLKBZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|