C19H11N3 — CID 126496742
2-(3-pyridin-2-ylphenyl)benzene-1,3-dicarbonitrile (PubChem CID 126496742) has the molecular formula C19H11N3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-(3-pyridin-2-ylphenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(3-pyridin-2-ylphenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 126496742 |
| Molecular Formula | C19H11N3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(3-pyridin-2-ylphenyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1-c1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C19H11N3/c20-12-16-7-4-8-17(13-21)19(16)15-6-3-5-14(11-15)18-9-1-2-10-22-18/h1-11H |
| InChIKey | XCBMCUXHWGTLLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |