C20H10N4 — CID 126496802
4-(3-pyridin-2-ylphenyl)benzene-1,2,3-tricarbonitrile (PubChem CID 126496802) has the molecular formula C20H10N4 and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-(3-pyridin-2-ylphenyl)benzene-1,2,3-tricarbonitrile.
| Compound Name | 4-(3-pyridin-2-ylphenyl)benzene-1,2,3-tricarbonitrile |
|---|---|
| PubChem CID | 126496802 |
| Molecular Formula | C20H10N4 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-(3-pyridin-2-ylphenyl)benzene-1,2,3-tricarbonitrile |
| SMILES | N#Cc1ccc(-c2cccc(-c3ccccn3)c2)c(C#N)c1C#N |
| InChI | InChI=1S/C20H10N4/c21-11-16-7-8-17(19(13-23)18(16)12-22)14-4-3-5-15(10-14)20-6-1-2-9-24-20/h1-10H |
| InChIKey | YSNALKNLKNROBX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |