C25H13N3O — CID 166043478
4-(3-cyanophenyl)-6-pyridin-2-yldibenzofuran-3-carbonitrile (PubChem CID 166043478) has the molecular formula C25H13N3O and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-(3-cyanophenyl)-6-pyridin-2-yldibenzofuran-3-carbonitrile.
| Compound Name | 4-(3-cyanophenyl)-6-pyridin-2-yldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166043478 |
| Molecular Formula | C25H13N3O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(3-cyanophenyl)-6-pyridin-2-yldibenzofuran-3-carbonitrile |
| SMILES | N#Cc1cccc(-c2c(C#N)ccc3c2oc2c(-c4ccccn4)cccc23)c1 |
| InChI | InChI=1S/C25H13N3O/c26-14-16-5-3-6-17(13-16)23-18(15-27)10-11-20-19-7-4-8-21(24(19)29-25(20)23)22-9-1-2-12-28-22/h1-13H |
| InChIKey | CGZAZRRQECPLPA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |