C32H30N2O — CID 167365859
6-pyridin-2-yl-4-(5,5,8,8-tetramethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 167365859) has the molecular formula C32H30N2O and a molecular weight of 458.61 g/mol. Its IUPAC name is 6-pyridin-2-yl-4-(5,5,8,8-tetramethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 6-pyridin-2-yl-4-(5,5,8,8-tetramethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 167365859 |
| Molecular Formula | C32H30N2O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 6-pyridin-2-yl-4-(5,5,8,8-tetramethyl-4a,6,7,8a-tetrahydronaphthalen-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | CC1(C)CCC(C)(C)C2C=C(c3c(C#N)ccc4c3oc3c(-c5ccccn5)cccc34)C=CC21 |
| InChI | InChI=1S/C32H30N2O/c1-31(2)15-16-32(3,4)26-18-20(12-14-25(26)31)28-21(19-33)11-13-23-22-8-7-9-24(29(22)35-30(23)28)27-10-5-6-17-34-27/h5-14,17-18,25-26H,15-16H2,1-4H3 |
| InChIKey | NNJAGAGLSTYFKC-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |