C22H18N2O — CID 170252554
6-(2-methylpropyl)-4-pyridin-2-yldibenzofuran-1-carbonitrile (PubChem CID 170252554) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is 6-(2-methylpropyl)-4-pyridin-2-yldibenzofuran-1-carbonitrile.
| Compound Name | 6-(2-methylpropyl)-4-pyridin-2-yldibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 170252554 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 6-(2-methylpropyl)-4-pyridin-2-yldibenzofuran-1-carbonitrile |
| SMILES | CC(C)Cc1cccc2c1oc1c(-c3ccccn3)ccc(C#N)c12 |
| InChI | InChI=1S/C22H18N2O/c1-14(2)12-15-6-5-7-18-20-16(13-23)9-10-17(22(20)25-21(15)18)19-8-3-4-11-24-19/h3-11,14H,12H2,1-2H3 |
| InChIKey | GECAGTLGPMDFKH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |