C28H22N2O — CID 170253714
9-(2-methylpropyl)-3-phenyl-6-pyridin-2-yldibenzofuran-4-carbonitrile (PubChem CID 170253714) has the molecular formula C28H22N2O and a molecular weight of 402.50 g/mol. Its IUPAC name is 9-(2-methylpropyl)-3-phenyl-6-pyridin-2-yldibenzofuran-4-carbonitrile.
| Compound Name | 9-(2-methylpropyl)-3-phenyl-6-pyridin-2-yldibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 170253714 |
| Molecular Formula | C28H22N2O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 9-(2-methylpropyl)-3-phenyl-6-pyridin-2-yldibenzofuran-4-carbonitrile |
| SMILES | CC(C)Cc1ccc(-c2ccccn2)c2oc3c(C#N)c(-c4ccccc4)ccc3c12 |
| InChI | InChI=1S/C28H22N2O/c1-18(2)16-20-11-12-22(25-10-6-7-15-30-25)28-26(20)23-14-13-21(19-8-4-3-5-9-19)24(17-29)27(23)31-28/h3-15,18H,16H2,1-2H3 |
| InChIKey | LMEKWOYWTAJMEG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |