C20H16N2Si — CID 154616018
2-(4-isocyano-5,5-dimethylbenzo[b][1]benzosilol-6-yl)pyridine (PubChem CID 154616018) has the molecular formula C20H16N2Si and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-(4-isocyano-5,5-dimethylbenzo[b][1]benzosilol-6-yl)pyridine.
| Compound Name | 2-(4-isocyano-5,5-dimethylbenzo[b][1]benzosilol-6-yl)pyridine |
|---|---|
| PubChem CID | 154616018 |
| Molecular Formula | C20H16N2Si |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(4-isocyano-5,5-dimethylbenzo[b][1]benzosilol-6-yl)pyridine |
| SMILES | [C-]#[N+]c1cccc2c1[Si](C)(C)c1c(-c3ccccn3)cccc1-2 |
| InChI | InChI=1S/C20H16N2Si/c1-21-18-12-7-9-15-14-8-6-10-16(17-11-4-5-13-22-17)19(14)23(2,3)20(15)18/h4-13H,2-3H3 |
| InChIKey | AUQDPSRNSGHMJI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|