C18H15InN — CID 158478788
CID 158478788 (PubChem CID 158478788) has the molecular formula C18H15InN and a molecular weight of 360.14 g/mol.
| Compound Name | CID 158478788 |
|---|---|
| PubChem CID | 158478788 |
| Molecular Formula | C18H15InN |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccccc2-c2ccccn2)cc1.[In] |
| InChI | InChI=1S/C18H15N.In/c1-14-9-11-15(12-10-14)16-6-2-3-7-17(16)18-8-4-5-13-19-18;/h2-13H,1H3; |
| InChIKey | HHGOLKNAXMSLQA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |